C25H16F4N2O5S — CID 17315609
2,3,5,6-tetrafluoro-4-methoxy-N-[[2-methoxy-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]benzamide (PubChem CID 17315609) has the molecular formula C25H16F4N2O5S and a molecular weight of 532.47 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-methoxy-N-[[2-methoxy-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-methoxy-N-[[2-methoxy-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17315609 |
| Molecular Formula | C25H16F4N2O5S |
| Molecular Weight | 532.47 g/mol |
| Exact Mass | 532.07 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-methoxy-N-[[2-methoxy-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]benzamide |
| SMILES | COc1ccc(-c2cc3ccccc3oc2=O)cc1NC(=S)NC(=O)c1c(F)c(F)c(OC)c(F)c1F |
| InChI | InChI=1S/C25H16F4N2O5S/c1-34-16-8-7-11(13-9-12-5-3-4-6-15(12)36-24(13)33)10-14(16)30-25(37)31-23(32)17-18(26)20(28)22(35-2)21(29)19(17)27/h3-10H,1-2H3,(H2,30,31,32,37) |
| InChIKey | HUVXCEOSBCSPNA-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 89.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.47 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|