C26H21N3O6S — CID 17112179
4-ethoxy-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]-3-nitrobenzamide (PubChem CID 17112179) has the molecular formula C26H21N3O6S and a molecular weight of 503.54 g/mol. Its IUPAC name is 4-ethoxy-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]-3-nitrobenzamide.
| Compound Name | 4-ethoxy-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]-3-nitrobenzamide |
|---|---|
| PubChem CID | 17112179 |
| Molecular Formula | C26H21N3O6S |
| Molecular Weight | 503.54 g/mol |
| Exact Mass | 503.12 |
| IUPAC Name | 4-ethoxy-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]-3-nitrobenzamide |
| SMILES | CCOc1ccc(C(=O)NC(=S)Nc2cc(-c3cc4ccccc4oc3=O)ccc2C)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C26H21N3O6S/c1-3-34-23-11-10-18(14-21(23)29(32)33)24(30)28-26(36)27-20-13-16(9-8-15(20)2)19-12-17-6-4-5-7-22(17)35-25(19)31/h4-14H,3H2,1-2H3,(H2,27,28,30,36) |
| InChIKey | KVKQBQSCTMHDHR-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 123.71 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 503.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|