C24H17ClN2O3S — CID 17109812
3-chloro-4-methyl-N-[[4-(2-oxochromen-3-yl)phenyl]carbamothioyl]benzamide (PubChem CID 17109812) has the molecular formula C24H17ClN2O3S and a molecular weight of 448.93 g/mol. Its IUPAC name is 3-chloro-4-methyl-N-[[4-(2-oxochromen-3-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-chloro-4-methyl-N-[[4-(2-oxochromen-3-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 17109812 |
| Molecular Formula | C24H17ClN2O3S |
| Molecular Weight | 448.93 g/mol |
| Exact Mass | 448.06 |
| IUPAC Name | 3-chloro-4-methyl-N-[[4-(2-oxochromen-3-yl)phenyl]carbamothioyl]benzamide |
| SMILES | Cc1ccc(C(=O)NC(=S)Nc2ccc(-c3cc4ccccc4oc3=O)cc2)cc1Cl |
| InChI | InChI=1S/C24H17ClN2O3S/c1-14-6-7-17(13-20(14)25)22(28)27-24(31)26-18-10-8-15(9-11-18)19-12-16-4-2-3-5-21(16)30-23(19)29/h2-13H,1H3,(H2,26,27,28,31) |
| InChIKey | FCIFRQOURQKDJZ-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 71.34 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 448.93 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|