C31H23ClN2O4S — CID 21169828
(E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 21169828) has the molecular formula C31H23ClN2O4S and a molecular weight of 555.06 g/mol. Its IUPAC name is (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 21169828 |
| Molecular Formula | C31H23ClN2O4S |
| Molecular Weight | 555.06 g/mol |
| Exact Mass | 554.11 |
| IUPAC Name | (E)-3-[5-(3-chloro-4-methylphenyl)furan-2-yl]-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | Cc1ccc(-c2ccc(/C=C/C(=O)NC(=S)Nc3cc(-c4cc5ccccc5oc4=O)ccc3C)o2)cc1Cl |
| InChI | InChI=1S/C31H23ClN2O4S/c1-18-7-10-22(16-25(18)32)28-13-11-23(37-28)12-14-29(35)34-31(39)33-26-17-20(9-8-19(26)2)24-15-21-5-3-4-6-27(21)38-30(24)36/h3-17H,1-2H3,(H2,33,34,35,39)/b14-12+ |
| InChIKey | BDQPWEHOBYIHJB-WYMLVPIESA-N |
| XLogP | 7.52 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.06 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|