C28H19ClN2O4S — CID 17112316
5-(4-chlorophenyl)-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 17112316) has the molecular formula C28H19ClN2O4S and a molecular weight of 514.99 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17112316 |
| Molecular Formula | C28H19ClN2O4S |
| Molecular Weight | 514.99 g/mol |
| Exact Mass | 514.08 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[[2-methyl-5-(2-oxochromen-3-yl)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | Cc1ccc(-c2cc3ccccc3oc2=O)cc1NC(=S)NC(=O)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C28H19ClN2O4S/c1-16-6-7-18(21-14-19-4-2-3-5-23(19)35-27(21)33)15-22(16)30-28(36)31-26(32)25-13-12-24(34-25)17-8-10-20(29)11-9-17/h2-15H,1H3,(H2,30,31,32,36) |
| InChIKey | VHSVFBDILUGQIO-UHFFFAOYSA-N |
| XLogP | 6.81 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 514.99 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|