C26H15Cl2N3O4S — CID 4627710
N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-5-(4-chlorophenyl)furan-2-carboxamide (PubChem CID 4627710) has the molecular formula C26H15Cl2N3O4S and a molecular weight of 536.40 g/mol. Its IUPAC name is N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-5-(4-chlorophenyl)furan-2-carboxamide.
| Compound Name | N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-5-(4-chlorophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 4627710 |
| Molecular Formula | C26H15Cl2N3O4S |
| Molecular Weight | 536.40 g/mol |
| Exact Mass | 535.02 |
| IUPAC Name | N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-5-(4-chlorophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc(N2C(=O)c3ccccc3C2=O)cc1Cl)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C26H15Cl2N3O4S/c27-15-7-5-14(6-8-15)21-11-12-22(35-21)23(32)30-26(36)29-20-10-9-16(13-19(20)28)31-24(33)17-3-1-2-4-18(17)25(31)34/h1-13H,(H2,29,30,32,36) |
| InChIKey | LSZUGQNLIRBJLO-UHFFFAOYSA-N |
| XLogP | 6.18 |
| TPSA | 91.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.40 |
| LogP ≤ 5 | 6.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|