C22H15ClN2O3S — CID 4262761
5-(4-chlorophenyl)-N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]furan-2-carboxamide (PubChem CID 4262761) has the molecular formula C22H15ClN2O3S and a molecular weight of 422.89 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 4262761 |
| Molecular Formula | C22H15ClN2O3S |
| Molecular Weight | 422.89 g/mol |
| Exact Mass | 422.05 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc2cc(O)ccc12)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C22H15ClN2O3S/c23-15-6-4-13(5-7-15)19-10-11-20(28-19)21(27)25-22(29)24-18-3-1-2-14-12-16(26)8-9-17(14)18/h1-12,26H,(H2,24,25,27,29) |
| InChIKey | VMNNOMMKVPKPNG-UHFFFAOYSA-N |
| XLogP | 5.59 |
| TPSA | 74.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.89 |
| LogP ≤ 5 | 5.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|