C18H12BrClN2O2S — CID 4995634
5-bromo-2-chloro-N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]benzamide (PubChem CID 4995634) has the molecular formula C18H12BrClN2O2S and a molecular weight of 435.73 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]benzamide |
|---|---|
| PubChem CID | 4995634 |
| Molecular Formula | C18H12BrClN2O2S |
| Molecular Weight | 435.73 g/mol |
| Exact Mass | 433.95 |
| IUPAC Name | 5-bromo-2-chloro-N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]benzamide |
| SMILES | O=C(NC(=S)Nc1cccc2cc(O)ccc12)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C18H12BrClN2O2S/c19-11-4-7-15(20)14(9-11)17(24)22-18(25)21-16-3-1-2-10-8-12(23)5-6-13(10)16/h1-9,23H,(H2,21,22,24,25) |
| InChIKey | ZLMLDLGRHLEZGZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.73 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|