C13H9BrClN3OS — CID 1224376
5-bromo-2-chloro-N-(pyridin-3-ylcarbamothioyl)benzamide (PubChem CID 1224376) has the molecular formula C13H9BrClN3OS and a molecular weight of 370.66 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-(pyridin-3-ylcarbamothioyl)benzamide.
| Compound Name | 5-bromo-2-chloro-N-(pyridin-3-ylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 1224376 |
| Molecular Formula | C13H9BrClN3OS |
| Molecular Weight | 370.66 g/mol |
| Exact Mass | 368.93 |
| IUPAC Name | 5-bromo-2-chloro-N-(pyridin-3-ylcarbamothioyl)benzamide |
| SMILES | O=C(NC(=S)Nc1cccnc1)c1cc(Br)ccc1Cl |
| InChI | InChI=1S/C13H9BrClN3OS/c14-8-3-4-11(15)10(6-8)12(19)18-13(20)17-9-2-1-5-16-7-9/h1-7H,(H2,17,18,19,20) |
| InChIKey | PFEMKKZTLNRLCF-UHFFFAOYSA-N |
| XLogP | 3.62 |
| TPSA | 54.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.66 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|