C20H17BrClN5O3S2 — CID 43914471
5-bromo-2-chloro-N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 43914471) has the molecular formula C20H17BrClN5O3S2 and a molecular weight of 554.88 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 43914471 |
| Molecular Formula | C20H17BrClN5O3S2 |
| Molecular Weight | 554.88 g/mol |
| Exact Mass | 552.96 |
| IUPAC Name | 5-bromo-2-chloro-N-[[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3cc(Br)ccc3Cl)cc2)n1 |
| InChI | InChI=1S/C20H17BrClN5O3S2/c1-11-9-12(2)24-19(23-11)27-32(29,30)15-6-4-14(5-7-15)25-20(31)26-18(28)16-10-13(21)3-8-17(16)22/h3-10H,1-2H3,(H,23,24,27)(H2,25,26,28,31) |
| InChIKey | UZHWWPWTMXKKIJ-UHFFFAOYSA-N |
| XLogP | 4.44 |
| TPSA | 113.08 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.88 |
| LogP ≤ 5 | 4.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|