C19H16ClIN4O3S — CID 43914888
2-chloro-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-5-iodobenzamide (PubChem CID 43914888) has the molecular formula C19H16ClIN4O3S and a molecular weight of 542.79 g/mol. Its IUPAC name is 2-chloro-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-5-iodobenzamide.
| Compound Name | 2-chloro-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-5-iodobenzamide |
|---|---|
| PubChem CID | 43914888 |
| Molecular Formula | C19H16ClIN4O3S |
| Molecular Weight | 542.79 g/mol |
| Exact Mass | 541.97 |
| IUPAC Name | 2-chloro-N-[4-[(4,6-dimethylpyrimidin-2-yl)sulfamoyl]phenyl]-5-iodobenzamide |
| SMILES | Cc1cc(C)nc(NS(=O)(=O)c2ccc(NC(=O)c3cc(I)ccc3Cl)cc2)n1 |
| InChI | InChI=1S/C19H16ClIN4O3S/c1-11-9-12(2)23-19(22-11)25-29(27,28)15-6-4-14(5-7-15)24-18(26)16-10-13(21)3-8-17(16)20/h3-10H,1-2H3,(H,24,26)(H,22,23,25) |
| InChIKey | YQSQWIHSEWUKEN-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 101.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.79 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|