C23H22BrN3O3S2 — CID 89089617
5-bromo-N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-methylbenzamide (PubChem CID 89089617) has the molecular formula C23H22BrN3O3S2 and a molecular weight of 532.49 g/mol. Its IUPAC name is 5-bromo-N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-methylbenzamide.
| Compound Name | 5-bromo-N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 89089617 |
| Molecular Formula | C23H22BrN3O3S2 |
| Molecular Weight | 532.49 g/mol |
| Exact Mass | 531.03 |
| IUPAC Name | 5-bromo-N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]-2-methylbenzamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3cc(Br)ccc3C)cc2)c1 |
| InChI | InChI=1S/C23H22BrN3O3S2/c1-14-10-15(2)12-19(11-14)27-32(29,30)20-8-6-18(7-9-20)25-23(31)26-22(28)21-13-17(24)5-4-16(21)3/h4-13,27H,1-3H3,(H2,25,26,28,31) |
| InChIKey | IAQZLKGWBYDZJV-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.49 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|