C26H28BrN3O3S2 — CID 5120786
3-bromo-4-tert-butyl-N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide (PubChem CID 5120786) has the molecular formula C26H28BrN3O3S2 and a molecular weight of 574.57 g/mol. Its IUPAC name is 3-bromo-4-tert-butyl-N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-tert-butyl-N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 5120786 |
| Molecular Formula | C26H28BrN3O3S2 |
| Molecular Weight | 574.57 g/mol |
| Exact Mass | 573.08 |
| IUPAC Name | 3-bromo-4-tert-butyl-N-[[4-[(3,5-dimethylphenyl)sulfamoyl]phenyl]carbamothioyl]benzamide |
| SMILES | Cc1cc(C)cc(NS(=O)(=O)c2ccc(NC(=S)NC(=O)c3ccc(C(C)(C)C)c(Br)c3)cc2)c1 |
| InChI | InChI=1S/C26H28BrN3O3S2/c1-16-12-17(2)14-20(13-16)30-35(32,33)21-9-7-19(8-10-21)28-25(34)29-24(31)18-6-11-22(23(27)15-18)26(3,4)5/h6-15,30H,1-5H3,(H2,28,29,31,34) |
| InChIKey | ZDTDLUSRORAFJF-UHFFFAOYSA-N |
| XLogP | 6.29 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 574.57 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|