C24H30BrN3O3S2 — CID 3319979
3-bromo-4-tert-butyl-N-[[4-(cyclohexylsulfamoyl)phenyl]carbamothioyl]benzamide (PubChem CID 3319979) has the molecular formula C24H30BrN3O3S2 and a molecular weight of 552.56 g/mol. Its IUPAC name is 3-bromo-4-tert-butyl-N-[[4-(cyclohexylsulfamoyl)phenyl]carbamothioyl]benzamide.
| Compound Name | 3-bromo-4-tert-butyl-N-[[4-(cyclohexylsulfamoyl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 3319979 |
| Molecular Formula | C24H30BrN3O3S2 |
| Molecular Weight | 552.56 g/mol |
| Exact Mass | 551.09 |
| IUPAC Name | 3-bromo-4-tert-butyl-N-[[4-(cyclohexylsulfamoyl)phenyl]carbamothioyl]benzamide |
| SMILES | CC(C)(C)c1ccc(C(=O)NC(=S)Nc2ccc(S(=O)(=O)NC3CCCCC3)cc2)cc1Br |
| InChI | InChI=1S/C24H30BrN3O3S2/c1-24(2,3)20-14-9-16(15-21(20)25)22(29)27-23(32)26-17-10-12-19(13-11-17)33(30,31)28-18-7-5-4-6-8-18/h9-15,18,28H,4-8H2,1-3H3,(H2,26,27,29,32) |
| InChIKey | GTHLZJZIEDKSEO-UHFFFAOYSA-N |
| XLogP | 5.48 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 552.56 |
| LogP ≤ 5 | 5.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|