C19H21BrClN4OS+ — CID 2197445
5-bromo-2-chloro-N-[[4-(4-methylpiperazin-4-ium-1-yl)phenyl]carbamothioyl]benzamide (PubChem CID 2197445) has the molecular formula C19H21BrClN4OS+ and a molecular weight of 468.83 g/mol. Its IUPAC name is 5-bromo-2-chloro-N-[[4-(4-methylpiperazin-4-ium-1-yl)phenyl]carbamothioyl]benzamide.
| Compound Name | 5-bromo-2-chloro-N-[[4-(4-methylpiperazin-4-ium-1-yl)phenyl]carbamothioyl]benzamide |
|---|---|
| PubChem CID | 2197445 |
| Molecular Formula | C19H21BrClN4OS+ |
| Molecular Weight | 468.83 g/mol |
| Exact Mass | 467.03 |
| IUPAC Name | 5-bromo-2-chloro-N-[[4-(4-methylpiperazin-4-ium-1-yl)phenyl]carbamothioyl]benzamide |
| SMILES | C[NH+]1CCN(c2ccc(NC(=S)NC(=O)c3cc(Br)ccc3Cl)cc2)CC1 |
| InChI | InChI=1S/C19H20BrClN4OS/c1-24-8-10-25(11-9-24)15-5-3-14(4-6-15)22-19(27)23-18(26)16-12-13(20)2-7-17(16)21/h2-7,12H,8-11H2,1H3,(H2,22,23,26,27)/p+1 |
| InChIKey | DQZKVAVJLPNERV-UHFFFAOYSA-O |
| XLogP | 2.56 |
| TPSA | 48.81 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 468.83 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|