C27H26BrClN4O4S — CID 17093004
5-bromo-N-[[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-2-methoxybenzamide (PubChem CID 17093004) has the molecular formula C27H26BrClN4O4S and a molecular weight of 617.95 g/mol. Its IUPAC name is 5-bromo-N-[[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 5-bromo-N-[[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 17093004 |
| Molecular Formula | C27H26BrClN4O4S |
| Molecular Weight | 617.95 g/mol |
| Exact Mass | 616.05 |
| IUPAC Name | 5-bromo-N-[[4-[4-(5-chloro-2-methoxybenzoyl)piperazin-1-yl]phenyl]carbamothioyl]-2-methoxybenzamide |
| SMILES | COc1ccc(Br)cc1C(=O)NC(=S)Nc1ccc(N2CCN(C(=O)c3cc(Cl)ccc3OC)CC2)cc1 |
| InChI | InChI=1S/C27H26BrClN4O4S/c1-36-23-9-3-17(28)15-21(23)25(34)31-27(38)30-19-5-7-20(8-6-19)32-11-13-33(14-12-32)26(35)22-16-18(29)4-10-24(22)37-2/h3-10,15-16H,11-14H2,1-2H3,(H2,30,31,34,38) |
| InChIKey | NJYKJTIXTVYOSU-UHFFFAOYSA-N |
| XLogP | 5.21 |
| TPSA | 83.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 617.95 |
| LogP ≤ 5 | 5.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|