C21H24BrClN4O2S — CID 4272270
5-bromo-N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-2-methoxybenzamide (PubChem CID 4272270) has the molecular formula C21H24BrClN4O2S and a molecular weight of 511.87 g/mol. Its IUPAC name is 5-bromo-N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-2-methoxybenzamide.
| Compound Name | 5-bromo-N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 4272270 |
| Molecular Formula | C21H24BrClN4O2S |
| Molecular Weight | 511.87 g/mol |
| Exact Mass | 510.05 |
| IUPAC Name | 5-bromo-N-[[3-chloro-4-(4-ethylpiperazin-1-yl)phenyl]carbamothioyl]-2-methoxybenzamide |
| SMILES | CCN1CCN(c2ccc(NC(=S)NC(=O)c3cc(Br)ccc3OC)cc2Cl)CC1 |
| InChI | InChI=1S/C21H24BrClN4O2S/c1-3-26-8-10-27(11-9-26)18-6-5-15(13-17(18)23)24-21(30)25-20(28)16-12-14(22)4-7-19(16)29-2/h4-7,12-13H,3,8-11H2,1-2H3,(H2,24,25,28,30) |
| InChIKey | JQTPHCIJDILKOX-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 56.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.87 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|