C20H16ClN3O4S — CID 10884485
5-(4-chlorophenyl)-N-[[(2-phenoxyacetyl)amino]carbamothioyl]furan-2-carboxamide (PubChem CID 10884485) has the molecular formula C20H16ClN3O4S and a molecular weight of 429.89 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-[[(2-phenoxyacetyl)amino]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-[[(2-phenoxyacetyl)amino]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 10884485 |
| Molecular Formula | C20H16ClN3O4S |
| Molecular Weight | 429.89 g/mol |
| Exact Mass | 429.06 |
| IUPAC Name | 5-(4-chlorophenyl)-N-[[(2-phenoxyacetyl)amino]carbamothioyl]furan-2-carboxamide |
| SMILES | O=C(COc1ccccc1)NNC(=S)NC(=O)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C20H16ClN3O4S/c21-14-8-6-13(7-9-14)16-10-11-17(28-16)19(26)22-20(29)24-23-18(25)12-27-15-4-2-1-3-5-15/h1-11H,12H2,(H,23,25)(H2,22,24,26,29) |
| InChIKey | QYTVRIXDDBVQOZ-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 92.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.89 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|