C22H15N3O5S — CID 3912520
N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide (PubChem CID 3912520) has the molecular formula C22H15N3O5S and a molecular weight of 433.45 g/mol. Its IUPAC name is N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide.
| Compound Name | N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3912520 |
| Molecular Formula | C22H15N3O5S |
| Molecular Weight | 433.45 g/mol |
| Exact Mass | 433.07 |
| IUPAC Name | N-[(6-hydroxynaphthalen-1-yl)carbamothioyl]-5-(2-nitrophenyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1cccc2cc(O)ccc12)c1ccc(-c2ccccc2[N+](=O)[O-])o1 |
| InChI | InChI=1S/C22H15N3O5S/c26-14-8-9-15-13(12-14)4-3-6-17(15)23-22(31)24-21(27)20-11-10-19(30-20)16-5-1-2-7-18(16)25(28)29/h1-12,26H,(H2,23,24,27,31) |
| InChIKey | HSWOMJDHMDVEOA-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 117.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.45 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|