C23H22N4O5S — CID 17109713
5-(2-nitrophenyl)-N-[[3-(pentanoylamino)phenyl]carbamothioyl]furan-2-carboxamide (PubChem CID 17109713) has the molecular formula C23H22N4O5S and a molecular weight of 466.52 g/mol. Its IUPAC name is 5-(2-nitrophenyl)-N-[[3-(pentanoylamino)phenyl]carbamothioyl]furan-2-carboxamide.
| Compound Name | 5-(2-nitrophenyl)-N-[[3-(pentanoylamino)phenyl]carbamothioyl]furan-2-carboxamide |
|---|---|
| PubChem CID | 17109713 |
| Molecular Formula | C23H22N4O5S |
| Molecular Weight | 466.52 g/mol |
| Exact Mass | 466.13 |
| IUPAC Name | 5-(2-nitrophenyl)-N-[[3-(pentanoylamino)phenyl]carbamothioyl]furan-2-carboxamide |
| SMILES | CCCCC(=O)Nc1cccc(NC(=S)NC(=O)c2ccc(-c3ccccc3[N+](=O)[O-])o2)c1 |
| InChI | InChI=1S/C23H22N4O5S/c1-2-3-11-21(28)24-15-7-6-8-16(14-15)25-23(33)26-22(29)20-13-12-19(32-20)17-9-4-5-10-18(17)27(30)31/h4-10,12-14H,2-3,11H2,1H3,(H,24,28)(H2,25,26,29,33) |
| InChIKey | DJQSBKZETFFCRK-UHFFFAOYSA-N |
| XLogP | 5.11 |
| TPSA | 126.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 466.52 |
| LogP ≤ 5 | 5.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|