C25H17ClN2O2S — CID 3831925
5-(4-chlorophenyl)-N-(9H-fluoren-2-ylcarbamothioyl)furan-2-carboxamide (PubChem CID 3831925) has the molecular formula C25H17ClN2O2S and a molecular weight of 444.94 g/mol. Its IUPAC name is 5-(4-chlorophenyl)-N-(9H-fluoren-2-ylcarbamothioyl)furan-2-carboxamide.
| Compound Name | 5-(4-chlorophenyl)-N-(9H-fluoren-2-ylcarbamothioyl)furan-2-carboxamide |
|---|---|
| PubChem CID | 3831925 |
| Molecular Formula | C25H17ClN2O2S |
| Molecular Weight | 444.94 g/mol |
| Exact Mass | 444.07 |
| IUPAC Name | 5-(4-chlorophenyl)-N-(9H-fluoren-2-ylcarbamothioyl)furan-2-carboxamide |
| SMILES | O=C(NC(=S)Nc1ccc2c(c1)Cc1ccccc1-2)c1ccc(-c2ccc(Cl)cc2)o1 |
| InChI | InChI=1S/C25H17ClN2O2S/c26-18-7-5-15(6-8-18)22-11-12-23(30-22)24(29)28-25(31)27-19-9-10-21-17(14-19)13-16-3-1-2-4-20(16)21/h1-12,14H,13H2,(H2,27,28,29,31) |
| InChIKey | JJLPGWRJJWPPAS-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 54.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.94 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|