C22H18N2OS — CID 3555410
N-(9H-fluoren-2-ylcarbamothioyl)-2-methylbenzamide (PubChem CID 3555410) has the molecular formula C22H18N2OS and a molecular weight of 358.47 g/mol. Its IUPAC name is N-(9H-fluoren-2-ylcarbamothioyl)-2-methylbenzamide.
| Compound Name | N-(9H-fluoren-2-ylcarbamothioyl)-2-methylbenzamide |
|---|---|
| PubChem CID | 3555410 |
| Molecular Formula | C22H18N2OS |
| Molecular Weight | 358.47 g/mol |
| Exact Mass | 358.11 |
| IUPAC Name | N-(9H-fluoren-2-ylcarbamothioyl)-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NC(=S)Nc1ccc2c(c1)Cc1ccccc1-2 |
| InChI | InChI=1S/C22H18N2OS/c1-14-6-2-4-8-18(14)21(25)24-22(26)23-17-10-11-20-16(13-17)12-15-7-3-5-9-19(15)20/h2-11,13H,12H2,1H3,(H2,23,24,25,26) |
| InChIKey | GZNPFQLLUPEYCO-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|