C19H18N2O5S — CID 4941786
dimethyl 5-[(2-methylbenzoyl)carbamothioylamino]benzene-1,3-dicarboxylate (PubChem CID 4941786) has the molecular formula C19H18N2O5S and a molecular weight of 386.43 g/mol. Its IUPAC name is dimethyl 5-[(2-methylbenzoyl)carbamothioylamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(2-methylbenzoyl)carbamothioylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 4941786 |
| Molecular Formula | C19H18N2O5S |
| Molecular Weight | 386.43 g/mol |
| Exact Mass | 386.09 |
| IUPAC Name | dimethyl 5-[(2-methylbenzoyl)carbamothioylamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=S)NC(=O)c2ccccc2C)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C19H18N2O5S/c1-11-6-4-5-7-15(11)16(22)21-19(27)20-14-9-12(17(23)25-2)8-13(10-14)18(24)26-3/h4-10H,1-3H3,(H2,20,21,22,27) |
| InChIKey | LEENHBHVVWWGLH-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 93.73 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.43 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|