C20H19BrN2O6S — CID 17113848
dimethyl 5-[(5-bromo-2-methoxy-3-methylbenzoyl)carbamothioylamino]benzene-1,3-dicarboxylate (PubChem CID 17113848) has the molecular formula C20H19BrN2O6S and a molecular weight of 495.35 g/mol. Its IUPAC name is dimethyl 5-[(5-bromo-2-methoxy-3-methylbenzoyl)carbamothioylamino]benzene-1,3-dicarboxylate.
| Compound Name | dimethyl 5-[(5-bromo-2-methoxy-3-methylbenzoyl)carbamothioylamino]benzene-1,3-dicarboxylate |
|---|---|
| PubChem CID | 17113848 |
| Molecular Formula | C20H19BrN2O6S |
| Molecular Weight | 495.35 g/mol |
| Exact Mass | 494.01 |
| IUPAC Name | dimethyl 5-[(5-bromo-2-methoxy-3-methylbenzoyl)carbamothioylamino]benzene-1,3-dicarboxylate |
| SMILES | COC(=O)c1cc(NC(=S)NC(=O)c2cc(Br)cc(C)c2OC)cc(C(=O)OC)c1 |
| InChI | InChI=1S/C20H19BrN2O6S/c1-10-5-13(21)9-15(16(10)27-2)17(24)23-20(30)22-14-7-11(18(25)28-3)6-12(8-14)19(26)29-4/h5-9H,1-4H3,(H2,22,23,24,30) |
| InChIKey | PXKROOWDSRDFEX-UHFFFAOYSA-N |
| XLogP | 3.47 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 495.35 |
| LogP ≤ 5 | 3.47 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|