C18H17BrN2O4S — CID 22780655
methyl 2-[(5-bromo-2-methoxy-3-methylbenzoyl)carbamothioylamino]benzoate (PubChem CID 22780655) has the molecular formula C18H17BrN2O4S and a molecular weight of 437.32 g/mol. Its IUPAC name is methyl 2-[(5-bromo-2-methoxy-3-methylbenzoyl)carbamothioylamino]benzoate.
| Compound Name | methyl 2-[(5-bromo-2-methoxy-3-methylbenzoyl)carbamothioylamino]benzoate |
|---|---|
| PubChem CID | 22780655 |
| Molecular Formula | C18H17BrN2O4S |
| Molecular Weight | 437.32 g/mol |
| Exact Mass | 436.01 |
| IUPAC Name | methyl 2-[(5-bromo-2-methoxy-3-methylbenzoyl)carbamothioylamino]benzoate |
| SMILES | COC(=O)c1ccccc1NC(=S)NC(=O)c1cc(Br)cc(C)c1OC |
| InChI | InChI=1S/C18H17BrN2O4S/c1-10-8-11(19)9-13(15(10)24-2)16(22)21-18(26)20-14-7-5-4-6-12(14)17(23)25-3/h4-9H,1-3H3,(H2,20,21,22,26) |
| InChIKey | HAYAPGDLEAURNN-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.32 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|