C23H19F3N2O2S — CID 134109537
N-[[3-methoxy-4-[4-(trifluoromethyl)phenyl]phenyl]carbamothioyl]-2-methylbenzamide (PubChem CID 134109537) has the molecular formula C23H19F3N2O2S and a molecular weight of 444.48 g/mol. Its IUPAC name is N-[[3-methoxy-4-[4-(trifluoromethyl)phenyl]phenyl]carbamothioyl]-2-methylbenzamide.
| Compound Name | N-[[3-methoxy-4-[4-(trifluoromethyl)phenyl]phenyl]carbamothioyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 134109537 |
| Molecular Formula | C23H19F3N2O2S |
| Molecular Weight | 444.48 g/mol |
| Exact Mass | 444.11 |
| IUPAC Name | N-[[3-methoxy-4-[4-(trifluoromethyl)phenyl]phenyl]carbamothioyl]-2-methylbenzamide |
| SMILES | COc1cc(NC(=S)NC(=O)c2ccccc2C)ccc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C23H19F3N2O2S/c1-14-5-3-4-6-18(14)21(29)28-22(31)27-17-11-12-19(20(13-17)30-2)15-7-9-16(10-8-15)23(24,25)26/h3-13H,1-2H3,(H2,27,28,29,31) |
| InChIKey | KWRXWDZUFMWZMR-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 444.48 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|