C22H15F6NO2 — CID 11430575
N-[4-[2,5-bis(trifluoromethyl)phenyl]phenyl]-2-methoxybenzamide (PubChem CID 11430575) has the molecular formula C22H15F6NO2 and a molecular weight of 439.36 g/mol. Its IUPAC name is N-[4-[2,5-bis(trifluoromethyl)phenyl]phenyl]-2-methoxybenzamide.
| Compound Name | N-[4-[2,5-bis(trifluoromethyl)phenyl]phenyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 11430575 |
| Molecular Formula | C22H15F6NO2 |
| Molecular Weight | 439.36 g/mol |
| Exact Mass | 439.10 |
| IUPAC Name | N-[4-[2,5-bis(trifluoromethyl)phenyl]phenyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)Nc1ccc(-c2cc(C(F)(F)F)ccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H15F6NO2/c1-31-19-5-3-2-4-16(19)20(30)29-15-9-6-13(7-10-15)17-12-14(21(23,24)25)8-11-18(17)22(26,27)28/h2-12H,1H3,(H,29,30) |
| InChIKey | PPSKETUMTSIHFN-UHFFFAOYSA-N |
| XLogP | 6.65 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.36 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |