C23H20F3NO4 — CID 29176493
2-[4-(trifluoromethyl)phenyl]-N-(3,4,5-trimethoxyphenyl)benzamide (PubChem CID 29176493) has the molecular formula C23H20F3NO4 and a molecular weight of 431.41 g/mol. Its IUPAC name is 2-[4-(trifluoromethyl)phenyl]-N-(3,4,5-trimethoxyphenyl)benzamide.
| Compound Name | 2-[4-(trifluoromethyl)phenyl]-N-(3,4,5-trimethoxyphenyl)benzamide |
|---|---|
| PubChem CID | 29176493 |
| Molecular Formula | C23H20F3NO4 |
| Molecular Weight | 431.41 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-[4-(trifluoromethyl)phenyl]-N-(3,4,5-trimethoxyphenyl)benzamide |
| SMILES | COc1cc(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C23H20F3NO4/c1-29-19-12-16(13-20(30-2)21(19)31-3)27-22(28)18-7-5-4-6-17(18)14-8-10-15(11-9-14)23(24,25)26/h4-13H,1-3H3,(H,27,28) |
| InChIKey | KEKLHBUOLYVUNU-UHFFFAOYSA-N |
| XLogP | 5.65 |
| TPSA | 56.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.41 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |