C25H25F3N2O4S — CID 4527529
N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-[4-(trifluoromethyl)phenyl]benzamide (PubChem CID 4527529) has the molecular formula C25H25F3N2O4S and a molecular weight of 506.55 g/mol. Its IUPAC name is N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-[4-(trifluoromethyl)phenyl]benzamide.
| Compound Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 4527529 |
| Molecular Formula | C25H25F3N2O4S |
| Molecular Weight | 506.55 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | N-[5-(diethylsulfamoyl)-2-methoxyphenyl]-2-[4-(trifluoromethyl)phenyl]benzamide |
| SMILES | CCN(CC)S(=O)(=O)c1ccc(OC)c(NC(=O)c2ccccc2-c2ccc(C(F)(F)F)cc2)c1 |
| InChI | InChI=1S/C25H25F3N2O4S/c1-4-30(5-2)35(32,33)19-14-15-23(34-3)22(16-19)29-24(31)21-9-7-6-8-20(21)17-10-12-18(13-11-17)25(26,27)28/h6-16H,4-5H2,1-3H3,(H,29,31) |
| InChIKey | JATXGYGXUSRQLP-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.55 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |