C23H19F3N2O3 — CID 90012211
2-[[(2-methoxybenzoyl)amino]methyl]-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 90012211) has the molecular formula C23H19F3N2O3 and a molecular weight of 428.41 g/mol. Its IUPAC name is 2-[[(2-methoxybenzoyl)amino]methyl]-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-[[(2-methoxybenzoyl)amino]methyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 90012211 |
| Molecular Formula | C23H19F3N2O3 |
| Molecular Weight | 428.41 g/mol |
| Exact Mass | 428.13 |
| IUPAC Name | 2-[[(2-methoxybenzoyl)amino]methyl]-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | COc1ccccc1C(=O)NCc1ccccc1C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C23H19F3N2O3/c1-31-20-12-5-4-11-19(20)21(29)27-14-15-7-2-3-10-18(15)22(30)28-17-9-6-8-16(13-17)23(24,25)26/h2-13H,14H2,1H3,(H,27,29)(H,28,30) |
| InChIKey | LQMHSGUTNHVAML-UHFFFAOYSA-N |
| XLogP | 4.90 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.41 |
| LogP ≤ 5 | 4.90 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |