C21H16F3NO — CID 2399730
2-benzyl-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 2399730) has the molecular formula C21H16F3NO and a molecular weight of 355.36 g/mol. Its IUPAC name is 2-benzyl-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-benzyl-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 2399730 |
| Molecular Formula | C21H16F3NO |
| Molecular Weight | 355.36 g/mol |
| Exact Mass | 355.12 |
| IUPAC Name | 2-benzyl-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1ccccc1Cc1ccccc1 |
| InChI | InChI=1S/C21H16F3NO/c22-21(23,24)17-10-6-11-18(14-17)25-20(26)19-12-5-4-9-16(19)13-15-7-2-1-3-8-15/h1-12,14H,13H2,(H,25,26) |
| InChIKey | BSVKBCPQLMCCMS-UHFFFAOYSA-N |
| XLogP | 5.55 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.36 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |