C27H20F3NO2 — CID 118043131
2-(2-phenylmethoxyphenyl)-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 118043131) has the molecular formula C27H20F3NO2 and a molecular weight of 447.46 g/mol. Its IUPAC name is 2-(2-phenylmethoxyphenyl)-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-(2-phenylmethoxyphenyl)-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 118043131 |
| Molecular Formula | C27H20F3NO2 |
| Molecular Weight | 447.46 g/mol |
| Exact Mass | 447.14 |
| IUPAC Name | 2-(2-phenylmethoxyphenyl)-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1ccccc1-c1ccccc1OCc1ccccc1 |
| InChI | InChI=1S/C27H20F3NO2/c28-27(29,30)20-11-8-12-21(17-20)31-26(32)24-15-5-4-13-22(24)23-14-6-7-16-25(23)33-18-19-9-2-1-3-10-19/h1-17H,18H2,(H,31,32) |
| InChIKey | QHNVHCMERKVEQK-UHFFFAOYSA-N |
| XLogP | 7.20 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.46 |
| LogP ≤ 5 | 7.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |