C15H9F6NO2 — CID 154341283
2-hydroxy-4-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 154341283) has the molecular formula C15H9F6NO2 and a molecular weight of 349.23 g/mol. Its IUPAC name is 2-hydroxy-4-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2-hydroxy-4-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 154341283 |
| Molecular Formula | C15H9F6NO2 |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 349.05 |
| IUPAC Name | 2-hydroxy-4-(trifluoromethyl)-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1ccc(C(F)(F)F)cc1O |
| InChI | InChI=1S/C15H9F6NO2/c16-14(17,18)8-2-1-3-10(6-8)22-13(24)11-5-4-9(7-12(11)23)15(19,20)21/h1-7,23H,(H,22,24) |
| InChIKey | QFDSUXINKHHLHP-UHFFFAOYSA-N |
| XLogP | 4.68 |
| TPSA | 49.33 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 4.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |