C15H8F4N2O — CID 833847
4-cyano-2-fluoro-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 833847) has the molecular formula C15H8F4N2O and a molecular weight of 308.23 g/mol. Its IUPAC name is 4-cyano-2-fluoro-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 4-cyano-2-fluoro-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 833847 |
| Molecular Formula | C15H8F4N2O |
| Molecular Weight | 308.23 g/mol |
| Exact Mass | 308.06 |
| IUPAC Name | 4-cyano-2-fluoro-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | N#Cc1ccc(C(=O)Nc2cccc(C(F)(F)F)c2)c(F)c1 |
| InChI | InChI=1S/C15H8F4N2O/c16-13-6-9(8-20)4-5-12(13)14(22)21-11-3-1-2-10(7-11)15(17,18)19/h1-7H,(H,21,22) |
| InChIKey | UBSKXCOGDZHJGW-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.23 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |