C14H6F7NO — CID 4542565
2,3,4,5-tetrafluoro-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 4542565) has the molecular formula C14H6F7NO and a molecular weight of 337.19 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 4542565 |
| Molecular Formula | C14H6F7NO |
| Molecular Weight | 337.19 g/mol |
| Exact Mass | 337.03 |
| IUPAC Name | 2,3,4,5-tetrafluoro-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=C(Nc1cccc(C(F)(F)F)c1)c1cc(F)c(F)c(F)c1F |
| InChI | InChI=1S/C14H6F7NO/c15-9-5-8(10(16)12(18)11(9)17)13(23)22-7-3-1-2-6(4-7)14(19,20)21/h1-5H,(H,22,23) |
| InChIKey | LMHRCVNOTHSPSY-UHFFFAOYSA-N |
| XLogP | 4.51 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.19 |
| LogP ≤ 5 | 4.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|