C15H6F7NO2 — CID 88891558
2,3,4,5-tetrafluoro-6-formyl-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 88891558) has the molecular formula C15H6F7NO2 and a molecular weight of 365.20 g/mol. Its IUPAC name is 2,3,4,5-tetrafluoro-6-formyl-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2,3,4,5-tetrafluoro-6-formyl-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 88891558 |
| Molecular Formula | C15H6F7NO2 |
| Molecular Weight | 365.20 g/mol |
| Exact Mass | 365.03 |
| IUPAC Name | 2,3,4,5-tetrafluoro-6-formyl-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | O=Cc1c(F)c(F)c(F)c(F)c1C(=O)Nc1cccc(C(F)(F)F)c1 |
| InChI | InChI=1S/C15H6F7NO2/c16-10-8(5-24)9(11(17)13(19)12(10)18)14(25)23-7-3-1-2-6(4-7)15(20,21)22/h1-5H,(H,23,25) |
| InChIKey | HAUACAKWOVWSOW-UHFFFAOYSA-N |
| XLogP | 4.33 |
| TPSA | 46.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.20 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|