C15H8F7NO — CID 170317070
2,3,5,6-tetrafluoro-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide (PubChem CID 170317070) has the molecular formula C15H8F7NO and a molecular weight of 351.22 g/mol. Its IUPAC name is 2,3,5,6-tetrafluoro-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide.
| Compound Name | 2,3,5,6-tetrafluoro-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide |
|---|---|
| PubChem CID | 170317070 |
| Molecular Formula | C15H8F7NO |
| Molecular Weight | 351.22 g/mol |
| Exact Mass | 351.05 |
| IUPAC Name | 2,3,5,6-tetrafluoro-4-methyl-N-[3-(trifluoromethyl)phenyl]benzamide |
| SMILES | Cc1c(F)c(F)c(C(=O)Nc2cccc(C(F)(F)F)c2)c(F)c1F |
| InChI | InChI=1S/C15H8F7NO/c1-6-10(16)12(18)9(13(19)11(6)17)14(24)23-8-4-2-3-7(5-8)15(20,21)22/h2-5H,1H3,(H,23,24) |
| InChIKey | GTZNWJJBBMWADA-UHFFFAOYSA-N |
| XLogP | 4.82 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.22 |
| LogP ≤ 5 | 4.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|