C14H11F3N2O3 — CID 54713541
4-hydroxy-6-methyl-2-oxo-N-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carboxamide (PubChem CID 54713541) has the molecular formula C14H11F3N2O3 and a molecular weight of 312.25 g/mol. Its IUPAC name is 4-hydroxy-6-methyl-2-oxo-N-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carboxamide.
| Compound Name | 4-hydroxy-6-methyl-2-oxo-N-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carboxamide |
|---|---|
| PubChem CID | 54713541 |
| Molecular Formula | C14H11F3N2O3 |
| Molecular Weight | 312.25 g/mol |
| Exact Mass | 312.07 |
| IUPAC Name | 4-hydroxy-6-methyl-2-oxo-N-[3-(trifluoromethyl)phenyl]-1H-pyridine-3-carboxamide |
| SMILES | Cc1cc(O)c(C(=O)Nc2cccc(C(F)(F)F)c2)c(=O)[nH]1 |
| InChI | InChI=1S/C14H11F3N2O3/c1-7-5-10(20)11(12(21)18-7)13(22)19-9-4-2-3-8(6-9)14(15,16)17/h2-6H,1H3,(H,19,22)(H2,18,20,21) |
| InChIKey | YCJACFJWNIYNHA-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.25 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |