C19H20F3N3O3 — CID 175181598
N-[[2-amino-4-[(3,3,3-trifluoro-2-methylpropanoyl)amino]phenyl]methyl]-2-methoxybenzamide (PubChem CID 175181598) has the molecular formula C19H20F3N3O3 and a molecular weight of 395.38 g/mol. Its IUPAC name is N-[[2-amino-4-[(3,3,3-trifluoro-2-methylpropanoyl)amino]phenyl]methyl]-2-methoxybenzamide.
| Compound Name | N-[[2-amino-4-[(3,3,3-trifluoro-2-methylpropanoyl)amino]phenyl]methyl]-2-methoxybenzamide |
|---|---|
| PubChem CID | 175181598 |
| Molecular Formula | C19H20F3N3O3 |
| Molecular Weight | 395.38 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | N-[[2-amino-4-[(3,3,3-trifluoro-2-methylpropanoyl)amino]phenyl]methyl]-2-methoxybenzamide |
| SMILES | COc1ccccc1C(=O)NCc1ccc(NC(=O)C(C)C(F)(F)F)cc1N |
| InChI | InChI=1S/C19H20F3N3O3/c1-11(19(20,21)22)17(26)25-13-8-7-12(15(23)9-13)10-24-18(27)14-5-3-4-6-16(14)28-2/h3-9,11H,10,23H2,1-2H3,(H,24,27)(H,25,26) |
| InChIKey | ZAVQXGADEWMYLV-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.38 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|