C18H17F4N3O3 — CID 175174643
N-[[2-amino-4-(3,3,3-trifluoropropanoylamino)phenyl]methyl]-5-fluoro-2-methoxybenzamide (PubChem CID 175174643) has the molecular formula C18H17F4N3O3 and a molecular weight of 399.34 g/mol. Its IUPAC name is N-[[2-amino-4-(3,3,3-trifluoropropanoylamino)phenyl]methyl]-5-fluoro-2-methoxybenzamide.
| Compound Name | N-[[2-amino-4-(3,3,3-trifluoropropanoylamino)phenyl]methyl]-5-fluoro-2-methoxybenzamide |
|---|---|
| PubChem CID | 175174643 |
| Molecular Formula | C18H17F4N3O3 |
| Molecular Weight | 399.34 g/mol |
| Exact Mass | 399.12 |
| IUPAC Name | N-[[2-amino-4-(3,3,3-trifluoropropanoylamino)phenyl]methyl]-5-fluoro-2-methoxybenzamide |
| SMILES | COc1ccc(F)cc1C(=O)NCc1ccc(NC(=O)CC(F)(F)F)cc1N |
| InChI | InChI=1S/C18H17F4N3O3/c1-28-15-5-3-11(19)6-13(15)17(27)24-9-10-2-4-12(7-14(10)23)25-16(26)8-18(20,21)22/h2-7H,8-9,23H2,1H3,(H,24,27)(H,25,26) |
| InChIKey | CRJPKRIMPRPXCS-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 93.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.34 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|