C22H14ClF6NO — CID 11248112
N-[4-[2,5-bis(trifluoromethyl)phenyl]phenyl]-3-chloro-2-methylbenzamide (PubChem CID 11248112) has the molecular formula C22H14ClF6NO and a molecular weight of 457.80 g/mol. Its IUPAC name is N-[4-[2,5-bis(trifluoromethyl)phenyl]phenyl]-3-chloro-2-methylbenzamide.
| Compound Name | N-[4-[2,5-bis(trifluoromethyl)phenyl]phenyl]-3-chloro-2-methylbenzamide |
|---|---|
| PubChem CID | 11248112 |
| Molecular Formula | C22H14ClF6NO |
| Molecular Weight | 457.80 g/mol |
| Exact Mass | 457.07 |
| IUPAC Name | N-[4-[2,5-bis(trifluoromethyl)phenyl]phenyl]-3-chloro-2-methylbenzamide |
| SMILES | Cc1c(Cl)cccc1C(=O)Nc1ccc(-c2cc(C(F)(F)F)ccc2C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H14ClF6NO/c1-12-16(3-2-4-19(12)23)20(31)30-15-8-5-13(6-9-15)17-11-14(21(24,25)26)7-10-18(17)22(27,28)29/h2-11H,1H3,(H,30,31) |
| InChIKey | ARBSTFMOMBBEPA-UHFFFAOYSA-N |
| XLogP | 7.61 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.80 |
| LogP ≤ 5 | 7.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |