C23H16ClN3O3S — CID 3519827
N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-2-methylbenzamide (PubChem CID 3519827) has the molecular formula C23H16ClN3O3S and a molecular weight of 449.92 g/mol. Its IUPAC name is N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-2-methylbenzamide.
| Compound Name | N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-2-methylbenzamide |
|---|---|
| PubChem CID | 3519827 |
| Molecular Formula | C23H16ClN3O3S |
| Molecular Weight | 449.92 g/mol |
| Exact Mass | 449.06 |
| IUPAC Name | N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]-2-methylbenzamide |
| SMILES | Cc1ccccc1C(=O)NC(=S)Nc1ccc(N2C(=O)c3ccccc3C2=O)cc1Cl |
| InChI | InChI=1S/C23H16ClN3O3S/c1-13-6-2-3-7-15(13)20(28)26-23(31)25-19-11-10-14(12-18(19)24)27-21(29)16-8-4-5-9-17(16)22(27)30/h2-12H,1H3,(H2,25,26,28,31) |
| InChIKey | OVCJOTGJGNLMAP-UHFFFAOYSA-N |
| XLogP | 4.58 |
| TPSA | 78.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.92 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|