C23H15BrClN3O4S — CID 4627474
2-(4-bromophenoxy)-N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]acetamide (PubChem CID 4627474) has the molecular formula C23H15BrClN3O4S and a molecular weight of 544.81 g/mol. Its IUPAC name is 2-(4-bromophenoxy)-N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]acetamide.
| Compound Name | 2-(4-bromophenoxy)-N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 4627474 |
| Molecular Formula | C23H15BrClN3O4S |
| Molecular Weight | 544.81 g/mol |
| Exact Mass | 542.97 |
| IUPAC Name | 2-(4-bromophenoxy)-N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]acetamide |
| SMILES | O=C(COc1ccc(Br)cc1)NC(=S)Nc1ccc(N2C(=O)c3ccccc3C2=O)cc1Cl |
| InChI | InChI=1S/C23H15BrClN3O4S/c24-13-5-8-15(9-6-13)32-12-20(29)27-23(33)26-19-10-7-14(11-18(19)25)28-21(30)16-3-1-2-4-17(16)22(28)31/h1-11H,12H2,(H2,26,27,29,33) |
| InChIKey | LKXLICHDUKOPIF-UHFFFAOYSA-N |
| XLogP | 4.80 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.81 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|