C22H18BrN3O3S — CID 3342560
2-[[2-(4-bromophenoxy)acetyl]carbamothioylamino]-N-phenylbenzamide (PubChem CID 3342560) has the molecular formula C22H18BrN3O3S and a molecular weight of 484.38 g/mol. Its IUPAC name is 2-[[2-(4-bromophenoxy)acetyl]carbamothioylamino]-N-phenylbenzamide.
| Compound Name | 2-[[2-(4-bromophenoxy)acetyl]carbamothioylamino]-N-phenylbenzamide |
|---|---|
| PubChem CID | 3342560 |
| Molecular Formula | C22H18BrN3O3S |
| Molecular Weight | 484.38 g/mol |
| Exact Mass | 483.03 |
| IUPAC Name | 2-[[2-(4-bromophenoxy)acetyl]carbamothioylamino]-N-phenylbenzamide |
| SMILES | O=C(COc1ccc(Br)cc1)NC(=S)Nc1ccccc1C(=O)Nc1ccccc1 |
| InChI | InChI=1S/C22H18BrN3O3S/c23-15-10-12-17(13-11-15)29-14-20(27)26-22(30)25-19-9-5-4-8-18(19)21(28)24-16-6-2-1-3-7-16/h1-13H,14H2,(H,24,28)(H2,25,26,27,30) |
| InChIKey | XIOWOKJBMWZNET-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 79.46 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.38 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|