C25H19Cl2N3O4S — CID 4627699
2-(4-chloro-3,5-dimethylphenoxy)-N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]acetamide (PubChem CID 4627699) has the molecular formula C25H19Cl2N3O4S and a molecular weight of 528.42 g/mol. Its IUPAC name is 2-(4-chloro-3,5-dimethylphenoxy)-N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]acetamide.
| Compound Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]acetamide |
|---|---|
| PubChem CID | 4627699 |
| Molecular Formula | C25H19Cl2N3O4S |
| Molecular Weight | 528.42 g/mol |
| Exact Mass | 527.05 |
| IUPAC Name | 2-(4-chloro-3,5-dimethylphenoxy)-N-[[2-chloro-4-(1,3-dioxoisoindol-2-yl)phenyl]carbamothioyl]acetamide |
| SMILES | Cc1cc(OCC(=O)NC(=S)Nc2ccc(N3C(=O)c4ccccc4C3=O)cc2Cl)cc(C)c1Cl |
| InChI | InChI=1S/C25H19Cl2N3O4S/c1-13-9-16(10-14(2)22(13)27)34-12-21(31)29-25(35)28-20-8-7-15(11-19(20)26)30-23(32)17-5-3-4-6-18(17)24(30)33/h3-11H,12H2,1-2H3,(H2,28,29,31,35) |
| InChIKey | FFFZSCASOWMIPB-UHFFFAOYSA-N |
| XLogP | 5.30 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.42 |
| LogP ≤ 5 | 5.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|