C30H20Cl2N2O4S — CID 17317254
(E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[[3-methyl-4-(2-oxochromen-3-yl)phenyl]carbamothioyl]prop-2-enamide (PubChem CID 17317254) has the molecular formula C30H20Cl2N2O4S and a molecular weight of 575.47 g/mol. Its IUPAC name is (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[[3-methyl-4-(2-oxochromen-3-yl)phenyl]carbamothioyl]prop-2-enamide.
| Compound Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[[3-methyl-4-(2-oxochromen-3-yl)phenyl]carbamothioyl]prop-2-enamide |
|---|---|
| PubChem CID | 17317254 |
| Molecular Formula | C30H20Cl2N2O4S |
| Molecular Weight | 575.47 g/mol |
| Exact Mass | 574.05 |
| IUPAC Name | (E)-3-[5-(2,4-dichlorophenyl)furan-2-yl]-N-[[3-methyl-4-(2-oxochromen-3-yl)phenyl]carbamothioyl]prop-2-enamide |
| SMILES | Cc1cc(NC(=S)NC(=O)/C=C/c2ccc(-c3ccc(Cl)cc3Cl)o2)ccc1-c1cc2ccccc2oc1=O |
| InChI | InChI=1S/C30H20Cl2N2O4S/c1-17-14-20(7-11-22(17)24-15-18-4-2-3-5-26(18)38-29(24)36)33-30(39)34-28(35)13-9-21-8-12-27(37-21)23-10-6-19(31)16-25(23)32/h2-16H,1H3,(H2,33,34,35,39)/b13-9+ |
| InChIKey | FKRHMYVGSYRMSJ-UKTHLTGXSA-N |
| XLogP | 7.86 |
| TPSA | 84.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 575.47 |
| LogP ≤ 5 | 7.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|