C23H18Cl3N3O3S — CID 17317204
(E)-N-[[2-chloro-5-(propanoylamino)phenyl]carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17317204) has the molecular formula C23H18Cl3N3O3S and a molecular weight of 522.84 g/mol. Its IUPAC name is (E)-N-[[2-chloro-5-(propanoylamino)phenyl]carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[[2-chloro-5-(propanoylamino)phenyl]carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17317204 |
| Molecular Formula | C23H18Cl3N3O3S |
| Molecular Weight | 522.84 g/mol |
| Exact Mass | 521.01 |
| IUPAC Name | (E)-N-[[2-chloro-5-(propanoylamino)phenyl]carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | CCC(=O)Nc1ccc(Cl)c(NC(=S)NC(=O)/C=C/c2ccc(-c3ccc(Cl)cc3Cl)o2)c1 |
| InChI | InChI=1S/C23H18Cl3N3O3S/c1-2-21(30)27-14-4-8-17(25)19(12-14)28-23(33)29-22(31)10-6-15-5-9-20(32-15)16-7-3-13(24)11-18(16)26/h3-12H,2H2,1H3,(H,27,30)(H2,28,29,31,33)/b10-6+ |
| InChIKey | OPFKNFRYXSRSDV-UXBLZVDNSA-N |
| XLogP | 6.78 |
| TPSA | 83.37 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.84 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|