C21H13Cl2N3O2S — CID 17103641
(E)-N-[(2-cyanophenyl)carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide (PubChem CID 17103641) has the molecular formula C21H13Cl2N3O2S and a molecular weight of 442.33 g/mol. Its IUPAC name is (E)-N-[(2-cyanophenyl)carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide.
| Compound Name | (E)-N-[(2-cyanophenyl)carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide |
|---|---|
| PubChem CID | 17103641 |
| Molecular Formula | C21H13Cl2N3O2S |
| Molecular Weight | 442.33 g/mol |
| Exact Mass | 441.01 |
| IUPAC Name | (E)-N-[(2-cyanophenyl)carbamothioyl]-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enamide |
| SMILES | N#Cc1ccccc1NC(=S)NC(=O)/C=C/c1ccc(-c2ccc(Cl)cc2Cl)o1 |
| InChI | InChI=1S/C21H13Cl2N3O2S/c22-14-5-8-16(17(23)11-14)19-9-6-15(28-19)7-10-20(27)26-21(29)25-18-4-2-1-3-13(18)12-24/h1-11H,(H2,25,26,27,29)/b10-7+ |
| InChIKey | PLWAKTNJBLEVKN-JXMROGBWSA-N |
| XLogP | 5.65 |
| TPSA | 78.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 442.33 |
| LogP ≤ 5 | 5.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|