C12H16N2O2S — CID 4927183
N-(3-hydroxypropylcarbamothioyl)-3-methylbenzamide (PubChem CID 4927183) has the molecular formula C12H16N2O2S and a molecular weight of 252.34 g/mol. Its IUPAC name is N-(3-hydroxypropylcarbamothioyl)-3-methylbenzamide.
| Compound Name | N-(3-hydroxypropylcarbamothioyl)-3-methylbenzamide |
|---|---|
| PubChem CID | 4927183 |
| Molecular Formula | C12H16N2O2S |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.09 |
| IUPAC Name | N-(3-hydroxypropylcarbamothioyl)-3-methylbenzamide |
| SMILES | Cc1cccc(C(=O)NC(=S)NCCCO)c1 |
| InChI | InChI=1S/C12H16N2O2S/c1-9-4-2-5-10(8-9)11(16)14-12(17)13-6-3-7-15/h2,4-5,8,15H,3,6-7H2,1H3,(H2,13,14,16,17) |
| InChIKey | YFIKJLIEILDJON-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|