C11H14N2O2S — CID 4927187
N-(3-hydroxypropylcarbamothioyl)benzamide (PubChem CID 4927187) has the molecular formula C11H14N2O2S and a molecular weight of 238.31 g/mol. Its IUPAC name is N-(3-hydroxypropylcarbamothioyl)benzamide.
| Compound Name | N-(3-hydroxypropylcarbamothioyl)benzamide |
|---|---|
| PubChem CID | 4927187 |
| Molecular Formula | C11H14N2O2S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.08 |
| IUPAC Name | N-(3-hydroxypropylcarbamothioyl)benzamide |
| SMILES | O=C(NC(=S)NCCCO)c1ccccc1 |
| InChI | InChI=1S/C11H14N2O2S/c14-8-4-7-12-11(16)13-10(15)9-5-2-1-3-6-9/h1-3,5-6,14H,4,7-8H2,(H2,12,13,15,16) |
| InChIKey | JOYPIBBKYLSFKS-UHFFFAOYSA-N |
| XLogP | 0.67 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 0.67 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|